C20H28FN5O6 — CID 162768411
2-[(5Z)-4,7-bis(carboxymethyl)-10-[(6-fluoro-2-pyridinyl)methyl]-1,4,7,10-tetrazacyclododec-5-en-1-yl]acetic acid (PubChem CID 162768411) has the molecular formula C20H28FN5O6 and a molecular weight of 453.47 g/mol. Its IUPAC name is 2-[(5Z)-4,7-bis(carboxymethyl)-10-[(6-fluoro-2-pyridinyl)methyl]-1,4,7,10-tetrazacyclododec-5-en-1-yl]acetic acid.
| Compound Name | 2-[(5Z)-4,7-bis(carboxymethyl)-10-[(6-fluoro-2-pyridinyl)methyl]-1,4,7,10-tetrazacyclododec-5-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 162768411 |
| Molecular Formula | C20H28FN5O6 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 2-[(5Z)-4,7-bis(carboxymethyl)-10-[(6-fluoro-2-pyridinyl)methyl]-1,4,7,10-tetrazacyclododec-5-en-1-yl]acetic acid |
| SMILES | O=C(O)CN1/C=C\N(CC(=O)O)CCN(Cc2cccc(F)n2)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H28FN5O6/c21-17-3-1-2-16(22-17)12-23-4-6-24(13-18(27)28)8-10-26(15-20(31)32)11-9-25(7-5-23)14-19(29)30/h1-3,8,10H,4-7,9,11-15H2,(H,27,28)(H,29,30)(H,31,32)/b10-8- |
| InChIKey | FGZKRJYFMTUAJP-NTMALXAHSA-N |
| XLogP | -0.33 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|