C38H59N7O11 — CID 11535329
2-[4,7-bis(carboxymethyl)-10-[2-oxo-2-[16-(quinolin-2-ylmethyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 11535329) has the molecular formula C38H59N7O11 and a molecular weight of 789.93 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-oxo-2-[16-(quinolin-2-ylmethyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-oxo-2-[16-(quinolin-2-ylmethyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 11535329 |
| Molecular Formula | C38H59N7O11 |
| Molecular Weight | 789.93 g/mol |
| Exact Mass | 789.43 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-oxo-2-[16-(quinolin-2-ylmethyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)N2CCOCCOCCN(Cc3ccc4ccccc4n3)CCOCCOCC2)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C38H59N7O11/c46-35(28-40-7-9-41(29-36(47)48)11-13-43(31-38(51)52)14-12-42(10-8-40)30-37(49)50)45-17-21-55-25-23-53-19-15-44(16-20-54-24-26-56-22-18-45)27-33-6-5-32-3-1-2-4-34(32)39-33/h1-6H,7-31H2,(H,47,48)(H,49,50)(H,51,52) |
| InChIKey | VVKHHUNJHIJIFZ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 198.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.93 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |