C30H36N2O2S — CID 126752608
ethyl 2-[4-(3-tritylsulfanylpropyl)piperazin-1-yl]acetate (PubChem CID 126752608) has the molecular formula C30H36N2O2S and a molecular weight of 488.70 g/mol. Its IUPAC name is ethyl 2-[4-(3-tritylsulfanylpropyl)piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-(3-tritylsulfanylpropyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 126752608 |
| Molecular Formula | C30H36N2O2S |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | ethyl 2-[4-(3-tritylsulfanylpropyl)piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(CCCSC(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H36N2O2S/c1-2-34-29(33)25-32-22-20-31(21-23-32)19-12-24-35-30(26-13-6-3-7-14-26,27-15-8-4-9-16-27)28-17-10-5-11-18-28/h3-11,13-18H,2,12,19-25H2,1H3 |
| InChIKey | COORAOOSARCLSE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|