C48H48N2O3S2 — CID 10628965
methyl 3-[[2-oxo-2-(2-tritylsulfanylethylamino)ethyl]-(2-tritylsulfanylethyl)amino]propanoate (PubChem CID 10628965) has the molecular formula C48H48N2O3S2 and a molecular weight of 765.06 g/mol. Its IUPAC name is methyl 3-[[2-oxo-2-(2-tritylsulfanylethylamino)ethyl]-(2-tritylsulfanylethyl)amino]propanoate.
| Compound Name | methyl 3-[[2-oxo-2-(2-tritylsulfanylethylamino)ethyl]-(2-tritylsulfanylethyl)amino]propanoate |
|---|---|
| PubChem CID | 10628965 |
| Molecular Formula | C48H48N2O3S2 |
| Molecular Weight | 765.06 g/mol |
| Exact Mass | 764.31 |
| IUPAC Name | methyl 3-[[2-oxo-2-(2-tritylsulfanylethylamino)ethyl]-(2-tritylsulfanylethyl)amino]propanoate |
| SMILES | COC(=O)CCN(CCSC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)NCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H48N2O3S2/c1-53-46(52)32-34-50(35-37-55-48(42-26-14-5-15-27-42,43-28-16-6-17-29-43)44-30-18-7-19-31-44)38-45(51)49-33-36-54-47(39-20-8-2-9-21-39,40-22-10-3-11-23-40)41-24-12-4-13-25-41/h2-31H,32-38H2,1H3,(H,49,51) |
| InChIKey | ZATVQNAESGHCDC-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.06 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|