C51H54N2O3S2 — CID 70271339
methyl 6-[[2-oxo-2-(2-tritylsulfanylethylamino)ethyl]-(2-tritylsulfanylethyl)amino]hexanoate (PubChem CID 70271339) has the molecular formula C51H54N2O3S2 and a molecular weight of 807.14 g/mol. Its IUPAC name is methyl 6-[[2-oxo-2-(2-tritylsulfanylethylamino)ethyl]-(2-tritylsulfanylethyl)amino]hexanoate.
| Compound Name | methyl 6-[[2-oxo-2-(2-tritylsulfanylethylamino)ethyl]-(2-tritylsulfanylethyl)amino]hexanoate |
|---|---|
| PubChem CID | 70271339 |
| Molecular Formula | C51H54N2O3S2 |
| Molecular Weight | 807.14 g/mol |
| Exact Mass | 806.36 |
| IUPAC Name | methyl 6-[[2-oxo-2-(2-tritylsulfanylethylamino)ethyl]-(2-tritylsulfanylethyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCN(CCSC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)NCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H54N2O3S2/c1-56-49(55)35-21-8-22-37-53(38-40-58-51(45-29-15-5-16-30-45,46-31-17-6-18-32-46)47-33-19-7-20-34-47)41-48(54)52-36-39-57-50(42-23-9-2-10-24-42,43-25-11-3-12-26-43)44-27-13-4-14-28-44/h2-7,9-20,23-34H,8,21-22,35-41H2,1H3,(H,52,54) |
| InChIKey | SVOOCISCCOKWBT-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.14 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|