C50H55N3OS2 — CID 11828805
2-[2-(diethylamino)ethyl-(2-tritylsulfanylethyl)amino]-N-(2-tritylsulfanylethyl)acetamide (PubChem CID 11828805) has the molecular formula C50H55N3OS2 and a molecular weight of 778.14 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethyl-(2-tritylsulfanylethyl)amino]-N-(2-tritylsulfanylethyl)acetamide.
| Compound Name | 2-[2-(diethylamino)ethyl-(2-tritylsulfanylethyl)amino]-N-(2-tritylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 11828805 |
| Molecular Formula | C50H55N3OS2 |
| Molecular Weight | 778.14 g/mol |
| Exact Mass | 777.38 |
| IUPAC Name | 2-[2-(diethylamino)ethyl-(2-tritylsulfanylethyl)amino]-N-(2-tritylsulfanylethyl)acetamide |
| SMILES | CCN(CC)CCN(CCSC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)NCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H55N3OS2/c1-3-52(4-2)36-37-53(38-40-56-50(45-29-17-8-18-30-45,46-31-19-9-20-32-46)47-33-21-10-22-34-47)41-48(54)51-35-39-55-49(42-23-11-5-12-24-42,43-25-13-6-14-26-43)44-27-15-7-16-28-44/h5-34H,3-4,35-41H2,1-2H3,(H,51,54) |
| InChIKey | IAHLDMYJAZERBQ-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.14 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|