C34H41N3O5S — CID 131732136
tert-butyl N-[2-oxo-2-(2-tritylsulfanylethylamino)ethyl]-N-[2-(prop-2-enoxycarbonylamino)ethyl]carbamate (PubChem CID 131732136) has the molecular formula C34H41N3O5S and a molecular weight of 603.78 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-(2-tritylsulfanylethylamino)ethyl]-N-[2-(prop-2-enoxycarbonylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-(2-tritylsulfanylethylamino)ethyl]-N-[2-(prop-2-enoxycarbonylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 131732136 |
| Molecular Formula | C34H41N3O5S |
| Molecular Weight | 603.78 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | tert-butyl N-[2-oxo-2-(2-tritylsulfanylethylamino)ethyl]-N-[2-(prop-2-enoxycarbonylamino)ethyl]carbamate |
| SMILES | C=CCOC(=O)NCCN(CC(=O)NCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H41N3O5S/c1-5-24-41-31(39)36-21-23-37(32(40)42-33(2,3)4)26-30(38)35-22-25-43-34(27-15-9-6-10-16-27,28-17-11-7-12-18-28)29-19-13-8-14-20-29/h5-20H,1,21-26H2,2-4H3,(H,35,38)(H,36,39) |
| InChIKey | MYSPNIGFVQPPER-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.78 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|