C40H49N3O7S — CID 177388985
2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(prop-2-enoxycarbonylamino)hexanoyl]-[(E)-1-tritylsulfanylbut-2-en-2-yl]amino]acetic acid (PubChem CID 177388985) has the molecular formula C40H49N3O7S and a molecular weight of 715.91 g/mol. Its IUPAC name is 2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(prop-2-enoxycarbonylamino)hexanoyl]-[(E)-1-tritylsulfanylbut-2-en-2-yl]amino]acetic acid.
| Compound Name | 2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(prop-2-enoxycarbonylamino)hexanoyl]-[(E)-1-tritylsulfanylbut-2-en-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 177388985 |
| Molecular Formula | C40H49N3O7S |
| Molecular Weight | 715.91 g/mol |
| Exact Mass | 715.33 |
| IUPAC Name | 2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(prop-2-enoxycarbonylamino)hexanoyl]-[(E)-1-tritylsulfanylbut-2-en-2-yl]amino]acetic acid |
| SMILES | C=CCOC(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)N(CC(=O)O)/C(=C/C)CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H49N3O7S/c1-6-27-49-38(48)42-34(25-17-18-26-41-37(47)50-39(3,4)5)36(46)43(28-35(44)45)33(7-2)29-51-40(30-19-11-8-12-20-30,31-21-13-9-14-22-31)32-23-15-10-16-24-32/h6-16,19-24,34H,1,17-18,25-29H2,2-5H3,(H,41,47)(H,42,48)(H,44,45)/b33-7+/t34-/m0/s1 |
| InChIKey | HJJSXOVSEKPIRN-RWWHGOKCSA-N |
| XLogP | 7.50 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.91 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|