C23H21NO3S — CID 11143657
2-oxo-2-(2-tritylsulfanylethylamino)acetic acid (PubChem CID 11143657) has the molecular formula C23H21NO3S and a molecular weight of 391.49 g/mol. Its IUPAC name is 2-oxo-2-(2-tritylsulfanylethylamino)acetic acid.
| Compound Name | 2-oxo-2-(2-tritylsulfanylethylamino)acetic acid |
|---|---|
| PubChem CID | 11143657 |
| Molecular Formula | C23H21NO3S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-oxo-2-(2-tritylsulfanylethylamino)acetic acid |
| SMILES | O=C(O)C(=O)NCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21NO3S/c25-21(22(26)27)24-16-17-28-23(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17H2,(H,24,25)(H,26,27) |
| InChIKey | JCIFTJBKJSWCDL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|