C26H26O3S — CID 145298413
2-hydroxy-7-tritylsulfanylhept-4-enoic acid (PubChem CID 145298413) has the molecular formula C26H26O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is 2-hydroxy-7-tritylsulfanylhept-4-enoic acid.
| Compound Name | 2-hydroxy-7-tritylsulfanylhept-4-enoic acid |
|---|---|
| PubChem CID | 145298413 |
| Molecular Formula | C26H26O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-hydroxy-7-tritylsulfanylhept-4-enoic acid |
| SMILES | O=C(O)C(O)CC=CCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26O3S/c27-24(25(28)29)19-11-4-12-20-30-26(21-13-5-1-6-14-21,22-15-7-2-8-16-22)23-17-9-3-10-18-23/h1-11,13-18,24,27H,12,19-20H2,(H,28,29) |
| InChIKey | QMAVLSCSKRZAJC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|