C25H22F5NO2S — CID 86610097
(2R)-2-(2,2,3,3,3-pentafluoropropylamino)-3-tritylsulfanylpropanoic acid (PubChem CID 86610097) has the molecular formula C25H22F5NO2S and a molecular weight of 495.51 g/mol. Its IUPAC name is (2R)-2-(2,2,3,3,3-pentafluoropropylamino)-3-tritylsulfanylpropanoic acid.
| Compound Name | (2R)-2-(2,2,3,3,3-pentafluoropropylamino)-3-tritylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 86610097 |
| Molecular Formula | C25H22F5NO2S |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (2R)-2-(2,2,3,3,3-pentafluoropropylamino)-3-tritylsulfanylpropanoic acid |
| SMILES | O=C(O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H22F5NO2S/c26-23(27,25(28,29)30)17-31-21(22(32)33)16-34-24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21,31H,16-17H2,(H,32,33)/t21-/m0/s1 |
| InChIKey | GVUVFBUKDPTWDL-NRFANRHFSA-N |
| XLogP | 5.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|