C28H25NO2S — CID 51356551
(2R)-2-amino-3-[diphenyl-(4-phenylphenyl)methyl]sulfanylpropanoic acid (PubChem CID 51356551) has the molecular formula C28H25NO2S and a molecular weight of 439.58 g/mol. Its IUPAC name is (2R)-2-amino-3-[diphenyl-(4-phenylphenyl)methyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[diphenyl-(4-phenylphenyl)methyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 51356551 |
| Molecular Formula | C28H25NO2S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (2R)-2-amino-3-[diphenyl-(4-phenylphenyl)methyl]sulfanylpropanoic acid |
| SMILES | N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H25NO2S/c29-26(27(30)31)20-32-28(23-12-6-2-7-13-23,24-14-8-3-9-15-24)25-18-16-22(17-19-25)21-10-4-1-5-11-21/h1-19,26H,20,29H2,(H,30,31)/t26-/m0/s1 |
| InChIKey | VUGRSCSBFOUEBX-SANMLTNESA-N |
| XLogP | 5.79 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|