C26H23NO2S — CID 24860488
(2R)-2-amino-3-[naphthalen-1-yl(diphenyl)methyl]sulfanylpropanoic acid (PubChem CID 24860488) has the molecular formula C26H23NO2S and a molecular weight of 413.54 g/mol. Its IUPAC name is (2R)-2-amino-3-[naphthalen-1-yl(diphenyl)methyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[naphthalen-1-yl(diphenyl)methyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 24860488 |
| Molecular Formula | C26H23NO2S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (2R)-2-amino-3-[naphthalen-1-yl(diphenyl)methyl]sulfanylpropanoic acid |
| SMILES | N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H23NO2S/c27-24(25(28)29)18-30-26(20-12-3-1-4-13-20,21-14-5-2-6-15-21)23-17-9-11-19-10-7-8-16-22(19)23/h1-17,24H,18,27H2,(H,28,29)/t24-/m0/s1 |
| InChIKey | WUEMKWIMYPFRNV-DEOSSOPVSA-N |
| XLogP | 5.28 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|