C12H18N4O2S — CID 21190662
tert-butyl N-[2-[(2,2-dicyano-1-methylsulfanylethenyl)amino]ethyl]carbamate (PubChem CID 21190662) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is tert-butyl N-[2-[(2,2-dicyano-1-methylsulfanylethenyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2,2-dicyano-1-methylsulfanylethenyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 21190662 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | tert-butyl N-[2-[(2,2-dicyano-1-methylsulfanylethenyl)amino]ethyl]carbamate |
| SMILES | CSC(NCCNC(=O)OC(C)(C)C)=C(C#N)C#N |
| InChI | InChI=1S/C12H18N4O2S/c1-12(2,3)18-11(17)16-6-5-15-10(19-4)9(7-13)8-14/h15H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | KIQHZSCBAUTARE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|