C12H22N2O4 — CID 46928823
methyl (Z)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]but-2-enoate (PubChem CID 46928823) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is methyl (Z)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]but-2-enoate.
| Compound Name | methyl (Z)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]but-2-enoate |
|---|---|
| PubChem CID | 46928823 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | methyl (Z)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]but-2-enoate |
| SMILES | COC(=O)/C=C(/C)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O4/c1-9(8-10(15)17-5)13-6-7-14-11(16)18-12(2,3)4/h8,13H,6-7H2,1-5H3,(H,14,16)/b9-8- |
| InChIKey | XEZVUCJSGKTUDE-HJWRWDBZSA-N |
| XLogP | 1.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|