C13H25N3O3 — CID 108914540
tert-butyl N-[2-[[(E)-2-methylbut-1-enyl]carbamoylamino]ethyl]carbamate (PubChem CID 108914540) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl N-[2-[[(E)-2-methylbut-1-enyl]carbamoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(E)-2-methylbut-1-enyl]carbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108914540 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | tert-butyl N-[2-[[(E)-2-methylbut-1-enyl]carbamoylamino]ethyl]carbamate |
| SMILES | CC/C(C)=C/NC(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25N3O3/c1-6-10(2)9-16-11(17)14-7-8-15-12(18)19-13(3,4)5/h9H,6-8H2,1-5H3,(H,15,18)(H2,14,16,17)/b10-9+ |
| InChIKey | JUCZMMHPTSPRMD-MDZDMXLPSA-N |
| XLogP | 2.12 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|