C11H16N2O5 — CID 101272333
methyl 2-cyano-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxobutanoate (PubChem CID 101272333) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is methyl 2-cyano-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxobutanoate.
| Compound Name | methyl 2-cyano-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxobutanoate |
|---|---|
| PubChem CID | 101272333 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | methyl 2-cyano-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxobutanoate |
| SMILES | COC(=O)C(C#N)C(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H16N2O5/c1-11(2,3)18-10(16)13-6-8(14)7(5-12)9(15)17-4/h7H,6H2,1-4H3,(H,13,16) |
| InChIKey | USMROQHCFJKQEE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|