C17H27N3O4 — CID 94365167
tert-butyl N-[(4S)-4-cyano-5-(cyclohexylamino)-3,5-dioxopentyl]carbamate (PubChem CID 94365167) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl N-[(4S)-4-cyano-5-(cyclohexylamino)-3,5-dioxopentyl]carbamate.
| Compound Name | tert-butyl N-[(4S)-4-cyano-5-(cyclohexylamino)-3,5-dioxopentyl]carbamate |
|---|---|
| PubChem CID | 94365167 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | tert-butyl N-[(4S)-4-cyano-5-(cyclohexylamino)-3,5-dioxopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)[C@H](C#N)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H27N3O4/c1-17(2,3)24-16(23)19-10-9-14(21)13(11-18)15(22)20-12-7-5-4-6-8-12/h12-13H,4-10H2,1-3H3,(H,19,23)(H,20,22)/t13-/m0/s1 |
| InChIKey | VNJVINIAJXMSCY-ZDUSSCGKSA-N |
| XLogP | 2.06 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|