C17H33NO5Si — CID 58604476
(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid (PubChem CID 58604476) has the molecular formula C17H33NO5Si and a molecular weight of 359.54 g/mol. Its IUPAC name is (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid.
| Compound Name | (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid |
|---|---|
| PubChem CID | 58604476 |
| Molecular Formula | C17H33NO5Si |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid |
| SMILES | C=CC[C@@](CO[Si](C)(C)C(C)(C)C)(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C17H33NO5Si/c1-10-11-17(13(19)20,18-14(21)23-15(2,3)4)12-22-24(8,9)16(5,6)7/h10H,1,11-12H2,2-9H3,(H,18,21)(H,19,20)/t17-/m0/s1 |
| InChIKey | JZMWNBVOPAZKLT-KRWDZBQOSA-N |
| XLogP | 3.93 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|