C19H39NO5Si — CID 175984659
tert-butyl N-[(2R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3-prop-2-enoxypropan-2-yl]carbamate (PubChem CID 175984659) has the molecular formula C19H39NO5Si and a molecular weight of 389.61 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3-prop-2-enoxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3-prop-2-enoxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 175984659 |
| Molecular Formula | C19H39NO5Si |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | tert-butyl N-[(2R)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3-prop-2-enoxypropan-2-yl]carbamate |
| SMILES | C=CCOC[C@H](COCCO[Si](C)(C)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H39NO5Si/c1-10-11-22-14-16(20-17(21)25-18(2,3)4)15-23-12-13-24-26(8,9)19(5,6)7/h10,16H,1,11-15H2,2-9H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | FKEKUWXVFISCQZ-MRXNPFEDSA-N |
| XLogP | 4.12 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|