C17H37NO4Si — CID 164575135
tert-butyl N-[(2R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methoxypentan-2-yl]carbamate (PubChem CID 164575135) has the molecular formula C17H37NO4Si and a molecular weight of 347.57 g/mol. Its IUPAC name is tert-butyl N-[(2R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methoxypentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methoxypentan-2-yl]carbamate |
|---|---|
| PubChem CID | 164575135 |
| Molecular Formula | C17H37NO4Si |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | tert-butyl N-[(2R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methoxypentan-2-yl]carbamate |
| SMILES | COC[C@@H](CCCO[Si](C)(C)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H37NO4Si/c1-16(2,3)22-15(19)18-14(13-20-7)11-10-12-21-23(8,9)17(4,5)6/h14H,10-13H2,1-9H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | RQHLSJGFZCYFST-CQSZACIVSA-N |
| XLogP | 4.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|