C15H34F3NO4Si3 — CID 91696802
N-[1,3-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)propan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 91696802) has the molecular formula C15H34F3NO4Si3 and a molecular weight of 433.69 g/mol. Its IUPAC name is N-[1,3-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)propan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1,3-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)propan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 91696802 |
| Molecular Formula | C15H34F3NO4Si3 |
| Molecular Weight | 433.69 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-[1,3-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)propan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[Si](C)(C)OCC(CO[Si](C)(C)C)(CO[Si](C)(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H34F3NO4Si3/c1-24(2,3)21-10-14(11-22-25(4,5)6,12-23-26(7,8)9)19-13(20)15(16,17)18/h10-12H2,1-9H3,(H,19,20) |
| InChIKey | LFQRITRFYUTBBV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.69 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|