C8H15F3N2O — CID 63889752
N-[3-(aminomethyl)pentan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 63889752) has the molecular formula C8H15F3N2O and a molecular weight of 212.21 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 63889752 |
| Molecular Formula | C8H15F3N2O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | CCC(CC)(CN)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O/c1-3-7(4-2,5-12)13-6(14)8(9,10)11/h3-5,12H2,1-2H3,(H,13,14) |
| InChIKey | XFGIPQNHKLGGTF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |