C12H26N2O3 — CID 107865773
2-(aminomethyl)-2-ethyl-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]butanamide (PubChem CID 107865773) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-(aminomethyl)-2-ethyl-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]butanamide.
| Compound Name | 2-(aminomethyl)-2-ethyl-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]butanamide |
|---|---|
| PubChem CID | 107865773 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 2-(aminomethyl)-2-ethyl-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]butanamide |
| SMILES | CCC(CO)(CO)NC(=O)C(CC)(CC)CN |
| InChI | InChI=1S/C12H26N2O3/c1-4-11(5-2,7-13)10(17)14-12(6-3,8-15)9-16/h15-16H,4-9,13H2,1-3H3,(H,14,17) |
| InChIKey | LHQMILRFYBSVBQ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |