C10H22N2O3 — CID 107865579
2-amino-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methylbutanamide (PubChem CID 107865579) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-amino-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methylbutanamide.
| Compound Name | 2-amino-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methylbutanamide |
|---|---|
| PubChem CID | 107865579 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-amino-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-methylbutanamide |
| SMILES | CCC(CO)(CO)NC(=O)C(C)(N)CC |
| InChI | InChI=1S/C10H22N2O3/c1-4-9(3,11)8(15)12-10(5-2,6-13)7-14/h13-14H,4-7,11H2,1-3H3,(H,12,15) |
| InChIKey | KVDDDFVSLWDRGJ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |