C11H24N2O2 — CID 64676838
3-amino-N-[3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide (PubChem CID 64676838) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-amino-N-[3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide.
| Compound Name | 3-amino-N-[3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 64676838 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 3-amino-N-[3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide |
| SMILES | CCC(CC)(CO)NC(=O)CC(C)(C)N |
| InChI | InChI=1S/C11H24N2O2/c1-5-11(6-2,8-14)13-9(15)7-10(3,4)12/h14H,5-8,12H2,1-4H3,(H,13,15) |
| InChIKey | VBEWWCKBMHRVKJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |