C10H18N2O — CID 64677680
3-amino-3-methyl-N-(2-methylbut-3-yn-2-yl)butanamide (PubChem CID 64677680) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-amino-3-methyl-N-(2-methylbut-3-yn-2-yl)butanamide.
| Compound Name | 3-amino-3-methyl-N-(2-methylbut-3-yn-2-yl)butanamide |
|---|---|
| PubChem CID | 64677680 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 3-amino-3-methyl-N-(2-methylbut-3-yn-2-yl)butanamide |
| SMILES | C#CC(C)(C)NC(=O)CC(C)(C)N |
| InChI | InChI=1S/C10H18N2O/c1-6-10(4,5)12-8(13)7-9(2,3)11/h1H,7,11H2,2-5H3,(H,12,13) |
| InChIKey | SWOGSFOOEOADPX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|