C10H21ClN2O3 — CID 86811663
3-[(3-amino-3-methylbutanoyl)amino]-3-methylbutanoic acid;hydrochloride (PubChem CID 86811663) has the molecular formula C10H21ClN2O3 and a molecular weight of 252.74 g/mol. Its IUPAC name is 3-[(3-amino-3-methylbutanoyl)amino]-3-methylbutanoic acid;hydrochloride.
| Compound Name | 3-[(3-amino-3-methylbutanoyl)amino]-3-methylbutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 86811663 |
| Molecular Formula | C10H21ClN2O3 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 3-[(3-amino-3-methylbutanoyl)amino]-3-methylbutanoic acid;hydrochloride |
| SMILES | CC(C)(N)CC(=O)NC(C)(C)CC(=O)O.Cl |
| InChI | InChI=1S/C10H20N2O3.ClH/c1-9(2,11)5-7(13)12-10(3,4)6-8(14)15;/h5-6,11H2,1-4H3,(H,12,13)(H,14,15);1H |
| InChIKey | WFGQFRDURJLYRO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |