3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid

C12H24N2O3 — CID 65265747

IUPAC3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid
SMILESCC(C)(N)CC(=O)NC(C)(C)C(C)(C)C(=O)O
InChIInChI=1S/C12H24N2O3/c1-10(2,13)7-8(15)14-12(5,6)11(3,4)9(16)17/h7,13H2,1-6H3,(H,14,15)(H,16,17)
InChIKeyGFNWXTBHWBQKCH-UHFFFAOYSA-N
MW244.33 g/mol
LogP1.12
Rot. Bonds5

About 3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid

3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid (PubChem CID 65265747) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid.

Molecular Properties

Compound Name3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid
PubChem CID65265747
Molecular FormulaC12H24N2O3
Molecular Weight244.33 g/mol
Exact Mass244.18
IUPAC Name3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid
SMILESCC(C)(N)CC(=O)NC(C)(C)C(C)(C)C(=O)O
InChIInChI=1S/C12H24N2O3/c1-10(2,13)7-8(15)14-12(5,6)11(3,4)9(16)17/h7,13H2,1-6H3,(H,14,15)(H,16,17)
InChIKeyGFNWXTBHWBQKCH-UHFFFAOYSA-N
XLogP1.12
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.33
LogP ≤ 51.12
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid?
The IUPAC name of 3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid (CID 65265747) is 3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid.
What is the SMILES notation for 3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid?
The canonical SMILES for 3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid is CC(C)(N)CC(=O)NC(C)(C)C(C)(C)C(=O)O.
What is the InChIKey of 3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid?
The InChIKey is GFNWXTBHWBQKCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3/c1-10(2,13)7-8(15)14-12(5,6)11(3,4)9(16)17/h7,13H2,1-6H3,(H,14,15)(H,16,17).
What are the key properties of 3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid?
3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid has a molecular weight of 244.33 g/mol, XLogP of 1.12, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-amino-3-methylbutanoyl)amino]-2,2,3-trimethylbutanoic acid is sourced from PubChem (CID 65265747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).