C13H25NO3S — CID 65261294
3-[(2-butylsulfanylacetyl)amino]-2,2,3-trimethylbutanoic acid (PubChem CID 65261294) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is 3-[(2-butylsulfanylacetyl)amino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[(2-butylsulfanylacetyl)amino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 65261294 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3-[(2-butylsulfanylacetyl)amino]-2,2,3-trimethylbutanoic acid |
| SMILES | CCCCSCC(=O)NC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H25NO3S/c1-6-7-8-18-9-10(15)14-13(4,5)12(2,3)11(16)17/h6-9H2,1-5H3,(H,14,15)(H,16,17) |
| InChIKey | FVYBYUREDYBXIB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|