C16H32N2O3 — CID 65266173
3-(dibutylcarbamoylamino)-2,2,3-trimethylbutanoic acid (PubChem CID 65266173) has the molecular formula C16H32N2O3 and a molecular weight of 300.44 g/mol. Its IUPAC name is 3-(dibutylcarbamoylamino)-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-(dibutylcarbamoylamino)-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 65266173 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | 3-(dibutylcarbamoylamino)-2,2,3-trimethylbutanoic acid |
| SMILES | CCCCN(CCCC)C(=O)NC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C16H32N2O3/c1-7-9-11-18(12-10-8-2)14(21)17-16(5,6)15(3,4)13(19)20/h7-12H2,1-6H3,(H,17,21)(H,19,20) |
| InChIKey | MTTDGBWMKUBYHT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |