C12H24N2O3 — CID 65265975
3-(diethylcarbamoylamino)-2,2,3-trimethylbutanoic acid (PubChem CID 65265975) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 3-(diethylcarbamoylamino)-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-(diethylcarbamoylamino)-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 65265975 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 3-(diethylcarbamoylamino)-2,2,3-trimethylbutanoic acid |
| SMILES | CCN(CC)C(=O)NC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H24N2O3/c1-7-14(8-2)10(17)13-12(5,6)11(3,4)9(15)16/h7-8H2,1-6H3,(H,13,17)(H,15,16) |
| InChIKey | OGRVOEVEFURLRC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |