C13H28N2O2 — CID 65265735
3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid (PubChem CID 65265735) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 65265735 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid |
| SMILES | CCN(CC)CCNC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H28N2O2/c1-7-15(8-2)10-9-14-13(5,6)12(3,4)11(16)17/h14H,7-10H2,1-6H3,(H,16,17) |
| InChIKey | QTYQZUSSZWFDAF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |