3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid

C13H28N2O2 — CID 65265735

IUPAC3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid
SMILESCCN(CC)CCNC(C)(C)C(C)(C)C(=O)O
InChIInChI=1S/C13H28N2O2/c1-7-15(8-2)10-9-14-13(5,6)12(3,4)11(16)17/h14H,7-10H2,1-6H3,(H,16,17)
InChIKeyQTYQZUSSZWFDAF-UHFFFAOYSA-N
MW244.38 g/mol
LogP1.81
Rot. Bonds8

About 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid

3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid (PubChem CID 65265735) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid.

Molecular Properties

Compound Name3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid
PubChem CID65265735
Molecular FormulaC13H28N2O2
Molecular Weight244.38 g/mol
Exact Mass244.22
IUPAC Name3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid
SMILESCCN(CC)CCNC(C)(C)C(C)(C)C(=O)O
InChIInChI=1S/C13H28N2O2/c1-7-15(8-2)10-9-14-13(5,6)12(3,4)11(16)17/h14H,7-10H2,1-6H3,(H,16,17)
InChIKeyQTYQZUSSZWFDAF-UHFFFAOYSA-N
XLogP1.81
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.38
LogP ≤ 51.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid?
The IUPAC name of 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid (CID 65265735) is 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid.
What is the SMILES notation for 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid?
The canonical SMILES for 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid is CCN(CC)CCNC(C)(C)C(C)(C)C(=O)O.
What is the InChIKey of 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid?
The InChIKey is QTYQZUSSZWFDAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O2/c1-7-15(8-2)10-9-14-13(5,6)12(3,4)11(16)17/h14H,7-10H2,1-6H3,(H,16,17).
What are the key properties of 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid?
3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid has a molecular weight of 244.38 g/mol, XLogP of 1.81, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(diethylamino)ethylamino]-2,2,3-trimethylbutanoic acid is sourced from PubChem (CID 65265735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).