About N-tert-butyl-N',N'-diethylethane-1,2-diamine;molecular hydrogen
N-tert-butyl-N',N'-diethylethane-1,2-diamine;molecular hydrogen (PubChem CID 142350039) has the molecular formula C10H26N2
and a molecular weight of 174.33 g/mol. Its IUPAC name is N-tert-butyl-N',N'-diethylethane-1,2-diamine;molecular hydrogen.
Analyze N-tert-butyl-N',N'-diethylethane-1,2-diamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N',N'-diethylethane-1,2-diamine;molecular hydrogen?
The IUPAC name of N-tert-butyl-N',N'-diethylethane-1,2-diamine;molecular hydrogen (CID 142350039) is N-tert-butyl-N',N'-diethylethane-1,2-diamine;molecular hydrogen.
What is the SMILES notation for N-tert-butyl-N',N'-diethylethane-1,2-diamine;molecular hydrogen?
The canonical SMILES for N-tert-butyl-N',N'-diethylethane-1,2-diamine;molecular hydrogen is CCN(CC)CCNC(C)(C)C.[H][H].
What is the InChIKey of N-tert-butyl-N',N'-diethylethane-1,2-diamine;molecular hydrogen?
The InChIKey is YBNQIBZKYJEYME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2.H2/c1-6-12(7-2)9-8-11-10(3,4)5;/h11H,6-9H2,1-5H3;1H.
What are the key properties of N-tert-butyl-N',N'-diethylethane-1,2-diamine;molecular hydrogen?
N-tert-butyl-N',N'-diethylethane-1,2-diamine;molecular hydrogen has a molecular weight of 174.33 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N',N'-diethylethane-1,2-diamine;molecular hydrogen is sourced from PubChem (CID 142350039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).