C11H22N2O4 — CID 114227468
3-[(4-amino-3-ethoxybutanoyl)amino]-3-methylbutanoic acid (PubChem CID 114227468) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-[(4-amino-3-ethoxybutanoyl)amino]-3-methylbutanoic acid.
| Compound Name | 3-[(4-amino-3-ethoxybutanoyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 114227468 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 3-[(4-amino-3-ethoxybutanoyl)amino]-3-methylbutanoic acid |
| SMILES | CCOC(CN)CC(=O)NC(C)(C)CC(=O)O |
| InChI | InChI=1S/C11H22N2O4/c1-4-17-8(7-12)5-9(14)13-11(2,3)6-10(15)16/h8H,4-7,12H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | IRKBAMSIBHULMH-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |