C12H24N2O4 — CID 114227387
methyl 2-[(4-amino-3-ethoxybutanoyl)amino]-3-methylbutanoate (PubChem CID 114227387) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is methyl 2-[(4-amino-3-ethoxybutanoyl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(4-amino-3-ethoxybutanoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 114227387 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | methyl 2-[(4-amino-3-ethoxybutanoyl)amino]-3-methylbutanoate |
| SMILES | CCOC(CN)CC(=O)NC(C(=O)OC)C(C)C |
| InChI | InChI=1S/C12H24N2O4/c1-5-18-9(7-13)6-10(15)14-11(8(2)3)12(16)17-4/h8-9,11H,5-7,13H2,1-4H3,(H,14,15) |
| InChIKey | LFWQORQSURNQNN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |