C9H17F3N2OS — CID 119569293
N-[3-(aminomethyl)pentan-3-yl]-2-(trifluoromethylsulfanyl)acetamide (PubChem CID 119569293) has the molecular formula C9H17F3N2OS and a molecular weight of 258.31 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-2-(trifluoromethylsulfanyl)acetamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-2-(trifluoromethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 119569293 |
| Molecular Formula | C9H17F3N2OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-2-(trifluoromethylsulfanyl)acetamide |
| SMILES | CCC(CC)(CN)NC(=O)CSC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2OS/c1-3-8(4-2,6-13)14-7(15)5-16-9(10,11)12/h3-6,13H2,1-2H3,(H,14,15) |
| InChIKey | PWYUNPYHOWXTCQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |