C14H28F3NO2Si — CID 156694094
N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 156694094) has the molecular formula C14H28F3NO2Si and a molecular weight of 327.46 g/mol. Its IUPAC name is N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 156694094 |
| Molecular Formula | C14H28F3NO2Si |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H28F3NO2Si/c1-12(2,3)10(18-11(19)14(15,16)17)9-20-21(7,8)13(4,5)6/h10H,9H2,1-8H3,(H,18,19)/t10-/m1/s1 |
| InChIKey | CTYVTVFMDQOMSI-SNVBAGLBSA-N |
| XLogP | 4.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|