C12H24F3NO5Si — CID 170908001
methyl (2S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropanoate;2,2,2-trifluoroacetic acid (PubChem CID 170908001) has the molecular formula C12H24F3NO5Si and a molecular weight of 347.41 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropanoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl (2S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170908001 |
| Molecular Formula | C12H24F3NO5Si |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | methyl (2S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxypropanoate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)[C@@H](N)CO[Si](C)(C)C(C)(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H23NO3Si.C2HF3O2/c1-10(2,3)15(5,6)14-7-8(11)9(12)13-4;3-2(4,5)1(6)7/h8H,7,11H2,1-6H3;(H,6,7)/t8-;/m0./s1 |
| InChIKey | LCQZURPURLTESI-QRPNPIFTSA-N |
| XLogP | 2.14 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|