C10H23NO4Si — CID 22607409
[1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropan-2-yl]carbamic acid (PubChem CID 22607409) has the molecular formula C10H23NO4Si and a molecular weight of 249.38 g/mol. Its IUPAC name is [1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropan-2-yl]carbamic acid.
| Compound Name | [1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 22607409 |
| Molecular Formula | C10H23NO4Si |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | [1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropan-2-yl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CO)NC(=O)O |
| InChI | InChI=1S/C10H23NO4Si/c1-10(2,3)16(4,5)15-7-8(6-12)11-9(13)14/h8,11-12H,6-7H2,1-5H3,(H,13,14) |
| InChIKey | WOJKJCCWWMSEJZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|