C31H40N2O4Si — CID 18672180
[1-[tert-butyl(dimethyl)silyl]oxy-5-oxo-5-(tritylamino)pentan-2-yl]carbamic acid (PubChem CID 18672180) has the molecular formula C31H40N2O4Si and a molecular weight of 532.76 g/mol. Its IUPAC name is [1-[tert-butyl(dimethyl)silyl]oxy-5-oxo-5-(tritylamino)pentan-2-yl]carbamic acid.
| Compound Name | [1-[tert-butyl(dimethyl)silyl]oxy-5-oxo-5-(tritylamino)pentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 18672180 |
| Molecular Formula | C31H40N2O4Si |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | [1-[tert-butyl(dimethyl)silyl]oxy-5-oxo-5-(tritylamino)pentan-2-yl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)O |
| InChI | InChI=1S/C31H40N2O4Si/c1-30(2,3)38(4,5)37-23-27(32-29(35)36)21-22-28(34)33-31(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,27,32H,21-23H2,1-5H3,(H,33,34)(H,35,36) |
| InChIKey | DZWKVWLJFHBUFY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|