C33H46N2O3Si — CID 67434977
tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-2-(tritylamino)propyl]carbamic acid (PubChem CID 67434977) has the molecular formula C33H46N2O3Si and a molecular weight of 546.83 g/mol. Its IUPAC name is tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-2-(tritylamino)propyl]carbamic acid.
| Compound Name | tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-2-(tritylamino)propyl]carbamic acid |
|---|---|
| PubChem CID | 67434977 |
| Molecular Formula | C33H46N2O3Si |
| Molecular Weight | 546.83 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-2-(tritylamino)propyl]carbamic acid |
| SMILES | CC(C)(C)N(CC(CO[Si](C)(C)C(C)(C)C)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C33H46N2O3Si/c1-31(2,3)35(30(36)37)24-29(25-38-39(7,8)32(4,5)6)34-33(26-18-12-9-13-19-26,27-20-14-10-15-21-27)28-22-16-11-17-23-28/h9-23,29,34H,24-25H2,1-8H3,(H,36,37) |
| InChIKey | XWNIPLQDEHUOMS-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.83 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|