C40H54BrNO2Si2 — CID 11686302
(2R)-1-[3-bromo-4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-[tert-butyl(dimethyl)silyl]oxy-N-tritylpropan-2-amine (PubChem CID 11686302) has the molecular formula C40H54BrNO2Si2 and a molecular weight of 716.95 g/mol. Its IUPAC name is (2R)-1-[3-bromo-4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-[tert-butyl(dimethyl)silyl]oxy-N-tritylpropan-2-amine.
| Compound Name | (2R)-1-[3-bromo-4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-[tert-butyl(dimethyl)silyl]oxy-N-tritylpropan-2-amine |
|---|---|
| PubChem CID | 11686302 |
| Molecular Formula | C40H54BrNO2Si2 |
| Molecular Weight | 716.95 g/mol |
| Exact Mass | 715.29 |
| IUPAC Name | (2R)-1-[3-bromo-4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-[tert-butyl(dimethyl)silyl]oxy-N-tritylpropan-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](Cc1ccc(O[Si](C)(C)C(C)(C)C)c(Br)c1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H54BrNO2Si2/c1-38(2,3)45(7,8)43-30-35(28-31-26-27-37(36(41)29-31)44-46(9,10)39(4,5)6)42-40(32-20-14-11-15-21-32,33-22-16-12-17-23-33)34-24-18-13-19-25-34/h11-27,29,35,42H,28,30H2,1-10H3/t35-/m1/s1 |
| InChIKey | PSRUDJFZMBJEKB-PGUFJCEWSA-N |
| XLogP | 11.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.95 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|