C26H47NO6Si2 — CID 67531897
(2S)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 67531897) has the molecular formula C26H47NO6Si2 and a molecular weight of 525.84 g/mol. Its IUPAC name is (2S)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 67531897 |
| Molecular Formula | C26H47NO6Si2 |
| Molecular Weight | 525.84 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | (2S)-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C26H47NO6Si2/c1-24(2,3)31-23(30)27-19(22(28)29)16-18-14-15-20(32-34(10,11)25(4,5)6)21(17-18)33-35(12,13)26(7,8)9/h14-15,17,19H,16H2,1-13H3,(H,27,30)(H,28,29)/t19-/m0/s1 |
| InChIKey | RLQAOWXHJAMOGO-IBGZPJMESA-N |
| XLogP | 6.97 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.84 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|