C23H40N2O5Si — CID 174983891
5-[3-amino-4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 174983891) has the molecular formula C23H40N2O5Si and a molecular weight of 452.67 g/mol. Its IUPAC name is 5-[3-amino-4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | 5-[3-amino-4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 174983891 |
| Molecular Formula | C23H40N2O5Si |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 5-[3-amino-4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | CC(CC(Cc1ccc(O[Si](C)(C)C(C)(C)C)c(N)c1)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C23H40N2O5Si/c1-15(20(26)27)12-17(25-21(28)29-22(2,3)4)13-16-10-11-19(18(24)14-16)30-31(8,9)23(5,6)7/h10-11,14-15,17H,12-13,24H2,1-9H3,(H,25,28)(H,26,27) |
| InChIKey | KJPZVFYHHGPVOR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|