C27H51NO6Si2 — CID 102196365
tert-butyl N-[(2S)-1-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxyphenyl]-3-hydroxypropan-2-yl]carbamate (PubChem CID 102196365) has the molecular formula C27H51NO6Si2 and a molecular weight of 541.88 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxyphenyl]-3-hydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxyphenyl]-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 102196365 |
| Molecular Formula | C27H51NO6Si2 |
| Molecular Weight | 541.88 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | tert-butyl N-[(2S)-1-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methoxyphenyl]-3-hydroxypropan-2-yl]carbamate |
| SMILES | COc1c(O[Si](C)(C)C(C)(C)C)cc(C[C@@H](CO)NC(=O)OC(C)(C)C)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H51NO6Si2/c1-25(2,3)32-24(30)28-20(18-29)15-19-16-21(33-35(11,12)26(4,5)6)23(31-10)22(17-19)34-36(13,14)27(7,8)9/h16-17,20,29H,15,18H2,1-14H3,(H,28,30)/t20-/m0/s1 |
| InChIKey | HVRGUVLQQXJAOD-FQEVSTJZSA-N |
| XLogP | 6.89 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.88 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|