C16H21NO4 — CID 140937790
tert-butyl N-[(2S)-1-(1-benzofuran-3-yl)-3-hydroxypropan-2-yl]carbamate (PubChem CID 140937790) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(1-benzofuran-3-yl)-3-hydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(1-benzofuran-3-yl)-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 140937790 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | tert-butyl N-[(2S)-1-(1-benzofuran-3-yl)-3-hydroxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)Cc1coc2ccccc12 |
| InChI | InChI=1S/C16H21NO4/c1-16(2,3)21-15(19)17-12(9-18)8-11-10-20-14-7-5-4-6-13(11)14/h4-7,10,12,18H,8-9H2,1-3H3,(H,17,19)/t12-/m0/s1 |
| InChIKey | DZBVYUMMDVIANR-LBPRGKRZSA-N |
| XLogP | 2.86 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |