C17H23NO3Se — CID 71746734
tert-butyl N-[(2R)-4-(1-benzoselenophen-3-yl)-1-hydroxybutan-2-yl]carbamate (PubChem CID 71746734) has the molecular formula C17H23NO3Se and a molecular weight of 368.34 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-(1-benzoselenophen-3-yl)-1-hydroxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-(1-benzoselenophen-3-yl)-1-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 71746734 |
| Molecular Formula | C17H23NO3Se |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | tert-butyl N-[(2R)-4-(1-benzoselenophen-3-yl)-1-hydroxybutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)CCc1c[se]c2ccccc12 |
| InChI | InChI=1S/C17H23NO3Se/c1-17(2,3)21-16(20)18-13(10-19)9-8-12-11-22-15-7-5-4-6-14(12)15/h4-7,11,13,19H,8-10H2,1-3H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | PHMWHRISPPEDHT-CYBMUJFWSA-N |
| XLogP | 2.71 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|