C23H35NO5 — CID 70370260
tert-butyl N-(1-hydroxy-3-naphthalen-1-ylpropan-2-yl)carbamate;ethoxymethoxyethane (PubChem CID 70370260) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is tert-butyl N-(1-hydroxy-3-naphthalen-1-ylpropan-2-yl)carbamate;ethoxymethoxyethane.
| Compound Name | tert-butyl N-(1-hydroxy-3-naphthalen-1-ylpropan-2-yl)carbamate;ethoxymethoxyethane |
|---|---|
| PubChem CID | 70370260 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | tert-butyl N-(1-hydroxy-3-naphthalen-1-ylpropan-2-yl)carbamate;ethoxymethoxyethane |
| SMILES | CC(C)(C)OC(=O)NC(CO)Cc1cccc2ccccc12.CCOCOCC |
| InChI | InChI=1S/C18H23NO3.C5H12O2/c1-18(2,3)22-17(21)19-15(12-20)11-14-9-6-8-13-7-4-5-10-16(13)14;1-3-6-5-7-4-2/h4-10,15,20H,11-12H2,1-3H3,(H,19,21);3-5H2,1-2H3 |
| InChIKey | IJMGWYMOYJUKQD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|