C15H23NO2S — CID 165466152
tert-butyl N-[1-(2-methylphenyl)-3-sulfanylpropan-2-yl]carbamate (PubChem CID 165466152) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is tert-butyl N-[1-(2-methylphenyl)-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-methylphenyl)-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 165466152 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | tert-butyl N-[1-(2-methylphenyl)-3-sulfanylpropan-2-yl]carbamate |
| SMILES | Cc1ccccc1CC(CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO2S/c1-11-7-5-6-8-12(11)9-13(10-19)16-14(17)18-15(2,3)4/h5-8,13,19H,9-10H2,1-4H3,(H,16,17) |
| InChIKey | ONIJVXPTLUMJMY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|